text
stringlengths
778
789
target
stringclasses
17 values
metadata
dict
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H14F4N2O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H15NO2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H25N3O3 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H16N2O2S2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22ClN3O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22ClN3O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H19NO4S2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H19NO4S2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H24N2O3 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H24N2O3 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H21N3O3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H21N3O3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H12N6O2S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H12N6O2S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H16N4O4 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H16N4O4 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H18FN3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H18FN3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20ClN2O3S- Degree of Unsaturation (DoU): 9.5 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20ClN2O3S- Degree of Unsaturation (DoU): 9.5 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H29N3O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H25N5O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H25N5O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H19F3N4O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H18F3NOS Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H18F3NOS Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H20F2N4O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H20F2N4O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H17F3N2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H17F3N2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H17N3O3S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H18O Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H26N2O Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H16O4 Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C=CC=C</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H16O4 Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1=CC1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H21N3O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H14F2N4O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H14F2N4O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H8F2N4O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H8F2N4O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H22N6O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22FN3O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22FN3O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H25NO4 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H18N4O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H18N4O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H18ClFN2O3S Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H24N6O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H24N6O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H26N2O2S Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H13F3N2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H13F3N2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H22N2O2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H17N3S2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20N2O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20N2O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H24N2O4 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H21NO3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H21NO3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H27N3O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H27N3O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H18F3NO3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H18F3NO3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H16ClNO3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H16ClNO3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H19N Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H19N Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H25BrN2O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H28N2O3S Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C=CC=C</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H28N2O3S Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1=CC1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H14F6N2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H14F6N2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H16F3N3O4 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O4S2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O4S2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H17ClN2O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H18N6O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H18N6O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H22FNO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H22FNO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H13F2NO2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H25N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H25N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H24N6O2S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H24N6O2S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H13N3O Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20N2O4 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20N2O4 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H13N2O5- Degree of Unsaturation (DoU): 9.5 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H13N2O5- Degree of Unsaturation (DoU): 9.5 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H26N2O4 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H26N2O3S Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H28N4O2S Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H20N4O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H20N4O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H19NO2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }