text
stringlengths
778
789
target
stringclasses
17 values
metadata
dict
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H21ClN2O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H21ClN2O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H13NO Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H22N2O2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H13IN2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H13IN2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H21FN2OS Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H19ClN2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H19ClN2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H18N4O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H18N4O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H14ClN3O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H14ClN3O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H20N4O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H20N4O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H19N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H19N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23FN2O3S Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H17N3O3S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H23N3O2S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O4S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O4S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H21ClN2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H21ClN2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H26N2O2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H26N2O2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H32N4O3 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H23N3O4 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H23N3O4 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22F3N3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22F3N3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H11ClN2S2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H11ClN2S2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H28N4O2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H21N3O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H21N3O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H16FN5OS Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H16FN5OS Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22F2N2O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22F2N2O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H22N2O2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H13ClO2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H13ClO2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H26N4O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H26N4O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H15ClF2N2O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H15ClF2N2O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H26N2O2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C10H11Cl2N5 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C10H11Cl2N5 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H20FN3O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H20FN3O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H21NO3 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H32N2O3 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H32N2O3 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H17N3O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22ClN3O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22ClN3O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H21N5OS Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H21N5OS Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H20N2O2S Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H23N3O3S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H24N2O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H24N2O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N4O4S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N4O4S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H23ClN4O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H11N5OS Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H11N5OS Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H15F3N2O Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C=CC=C</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H15F3N2O Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1=CC1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H23ClN4O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H21N5OS2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H21N5OS2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H18ClN3O Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H33N3O2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H17N3O4S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H23NO Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H20N2O7S2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H20N2O7S2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H28N2O3 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C10H16N2O2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C10H16N2O2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H18BrClN2O Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C24H32N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C24H32N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H15Cl2NO2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H15Cl2NO2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H29N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H29N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H22N2O3S Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C=CC=C</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H22N2O3S Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1=CC1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H19F2N5O2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H14ClFN2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H14ClFN2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H19N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H19N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H19NO4S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H19NO4S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H14F4N2O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }