text
stringlengths
778
789
target
stringclasses
17 values
metadata
dict
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C8H12N2O2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C22H28N2O7S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C22H28N2O7S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H22N4O Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H19N5O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H19N5O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H27N3O4 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22FNO3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22FNO3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H15BrClN3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H15BrClN3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H15F3N4O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H25N3O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H25N3O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H14Cl3NOS Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H18N2O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H18N2O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H27N3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H27N3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H14N2O2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H14N2O2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H15BrClNO2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H18BrFN2O2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H18N2O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H18N2O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C21H31N3O3 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C23H32N4O Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C23H32N4O Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H19ClN4O3 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H15ClFN3O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H15ClFN3O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H19ClFN3OS Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H19ClFN3OS Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H14ClNO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H14ClNO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H15BrN2O2S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H15BrN2O2S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H18ClF3N4O2S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H18ClF3N4O2S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C23H32N4O4 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C23H32N4O4 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H13N5O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H13N5O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H18F3N3O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H18F3N3O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H23NOS Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H23NOS Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H20N4O3S Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H16BrNO2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H26N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H26N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23FN2O3 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H26N2O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H26N2O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H15N3O2S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H15N3O2S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H17ClN2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H17ClN2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H22N6O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H22N6O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H23F2NO4 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H23F2NO4 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23NO3 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O4 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N2O4 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H13ClN2O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H13ClN2O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H24N2OS Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H24N2OS Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C6H8N6OS2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20N2OS Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20N2OS Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H19NO3 Degree of Unsaturation (DoU): 1.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C=CCC</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H19NO3 Degree of Unsaturation (DoU): 1.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1CCCCC1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H12ClN3O3S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H12ClN3O3S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H21N3O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H21N3O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H13F3N4O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H13F3N4O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H23N3O5 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H23N3O5 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H27N3O Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H24N2O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H24N2O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22ClN3O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H22ClN3O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C21H28ClN3O4S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C21H28ClN3O4S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H16ClN7O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H16ClN7O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H28N2O3S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23NO3 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H25N5O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }