text
stringlengths
778
789
target
stringclasses
17 values
metadata
dict
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H14N2O2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H14N2O2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H12ClN5 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H12ClN5 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H23N3O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H23N3O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H12N2O2S2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C10H14N4O2S Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H18N2O3 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H27F3N2O2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H19ClN2O3 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H12ClF3N2O5S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H12ClF3N2O5S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H20O2 Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C=CC=C</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H20O2 Degree of Unsaturation (DoU): 2.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1=CC1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H16ClN3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H16ClN3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H18ClNO3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H18ClNO3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H12BrF2NO3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H12BrF2NO3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C6H2F3I Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C6H2F3I Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H22N4O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H30N6O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H17NO3 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H6N2O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H20N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H20N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H23F2N3O2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H17NO3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H17NO3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H18F3N3O2S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H21F3N2O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H21F3N2O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H17N3O2S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H17N3O2S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H21ClN2O4 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H21ClN2O4 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H7F5O Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H7F5O Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H15N3O Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H15N3O Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H15Cl2N3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H15Cl2N3O Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H9N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C9H9N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H13Cl2NO3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H13Cl2NO3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20FNO3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H20FNO3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C8H9Cl3N2O Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C8H9Cl3N2O Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H16N2O2S2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H16N2O2S2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H19ClN6O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H19ClN6O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H13BrN2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H13BrN2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H24N4O2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H21N3O2S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H19N5OS Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H19N5OS Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H12FNO4 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H12FNO4 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H23NO2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H23NO2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H24N2O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H24N2O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H24N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C20H24N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H18N2O3 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C12H16O2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H19FN2O2S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C19H34N4O2 Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H18BrClN2O Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H18BrClN2O Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H27NO4S Degree of Unsaturation (DoU): 3.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccoc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H27NO4S Degree of Unsaturation (DoU): 3.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cc[nH]c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H17NO3S2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H22N2O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H22N2O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C11H17N3O2S Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H21N3O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H21N3O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H19N3O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C17H19N3O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H13FN2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C15H18N2O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H19NO4S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H19NO4S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H25N3O2S Degree of Unsaturation (DoU): 3.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccoc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C13H25N3O2S Degree of Unsaturation (DoU): 3.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cc[nH]c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H25NO2S Degree of Unsaturation (DoU): 3.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccoc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C14H25NO2S Degree of Unsaturation (DoU): 3.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1cc[nH]c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H16BrFN2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C16H16BrFN2O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N4O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H22N4O3S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The generated SMILES string *must* be chemically valid. * The generated scaffold *must* be consistent with the provided Molecular Formula and DoU. 4. **Output:** Respond *only* with the generated SMILES string enclosed in <answer> tags, like this: <answer>SMILES_STRING</answer> Molecular Formula: C18H23BrN2O5 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }